C14H26O5 — CID 162416214
(2R)-2-[(4R)-5-[(1R)-1-(methoxymethoxy)propyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanal (PubChem CID 162416214) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2R)-2-[(4R)-5-[(1R)-1-(methoxymethoxy)propyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanal.
| Compound Name | (2R)-2-[(4R)-5-[(1R)-1-(methoxymethoxy)propyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanal |
|---|---|
| PubChem CID | 162416214 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (2R)-2-[(4R)-5-[(1R)-1-(methoxymethoxy)propyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanal |
| SMILES | CC[C@@H](OCOC)C1(C)OC(C)(C)O[C@@H]1[C@@H](C)C=O |
| InChI | InChI=1S/C14H26O5/c1-7-11(17-9-16-6)14(5)12(10(2)8-15)18-13(3,4)19-14/h8,10-12H,7,9H2,1-6H3/t10-,11+,12+,14?/m0/s1 |
| InChIKey | BVKCHDGVWARBNJ-JVMKAEFSSA-N |
| XLogP | 2.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|