C20H16BrNO4 — CID 162416353
(1R,3S,3aS,9aS)-6-bromo-1-phenylspiro[1,2,3a,9a-tetrahydrochromeno[2,3-c]pyrrole-3,3'-oxolane]-2',9-dione (PubChem CID 162416353) has the molecular formula C20H16BrNO4 and a molecular weight of 414.26 g/mol. Its IUPAC name is (1R,3S,3aS,9aS)-6-bromo-1-phenylspiro[1,2,3a,9a-tetrahydrochromeno[2,3-c]pyrrole-3,3'-oxolane]-2',9-dione.
| Compound Name | (1R,3S,3aS,9aS)-6-bromo-1-phenylspiro[1,2,3a,9a-tetrahydrochromeno[2,3-c]pyrrole-3,3'-oxolane]-2',9-dione |
|---|---|
| PubChem CID | 162416353 |
| Molecular Formula | C20H16BrNO4 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | (1R,3S,3aS,9aS)-6-bromo-1-phenylspiro[1,2,3a,9a-tetrahydrochromeno[2,3-c]pyrrole-3,3'-oxolane]-2',9-dione |
| SMILES | O=C1c2ccc(Br)cc2O[C@H]2[C@@H]1[C@H](c1ccccc1)N[C@@]21CCOC1=O |
| InChI | InChI=1S/C20H16BrNO4/c21-12-6-7-13-14(10-12)26-18-15(17(13)23)16(11-4-2-1-3-5-11)22-20(18)8-9-25-19(20)24/h1-7,10,15-16,18,22H,8-9H2/t15-,16+,18+,20+/m1/s1 |
| InChIKey | CURCEEYQROAQEN-JMVFIXPQSA-N |
| XLogP | 3.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |