C22H32O5S2 — CID 162416383
(1R,5R,6S,9R,13R)-13-(methoxymethoxy)-3,3-dimethyl-6-(2-phenylmethoxyethyl)-2,4-dioxa-8,10-dithiatricyclo[7.4.0.01,5]tridecane (PubChem CID 162416383) has the molecular formula C22H32O5S2 and a molecular weight of 440.63 g/mol. Its IUPAC name is (1R,5R,6S,9R,13R)-13-(methoxymethoxy)-3,3-dimethyl-6-(2-phenylmethoxyethyl)-2,4-dioxa-8,10-dithiatricyclo[7.4.0.01,5]tridecane.
| Compound Name | (1R,5R,6S,9R,13R)-13-(methoxymethoxy)-3,3-dimethyl-6-(2-phenylmethoxyethyl)-2,4-dioxa-8,10-dithiatricyclo[7.4.0.01,5]tridecane |
|---|---|
| PubChem CID | 162416383 |
| Molecular Formula | C22H32O5S2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (1R,5R,6S,9R,13R)-13-(methoxymethoxy)-3,3-dimethyl-6-(2-phenylmethoxyethyl)-2,4-dioxa-8,10-dithiatricyclo[7.4.0.01,5]tridecane |
| SMILES | COCO[C@@H]1CCS[C@@H]2SC[C@@H](CCOCc3ccccc3)[C@H]3OC(C)(C)O[C@@]231 |
| InChI | InChI=1S/C22H32O5S2/c1-21(2)26-19-17(9-11-24-13-16-7-5-4-6-8-16)14-29-20-22(19,27-21)18(10-12-28-20)25-15-23-3/h4-8,17-20H,9-15H2,1-3H3/t17-,18-,19-,20-,22-/m1/s1 |
| InChIKey | RKUMFPSBGZTMKZ-CDVBAKLBSA-N |
| XLogP | 4.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|