C38H44N6+2 — CID 162416394
1,4-bis[(4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene]piperazine-1,4-diium (PubChem CID 162416394) has the molecular formula C38H44N6+2 and a molecular weight of 584.81 g/mol. Its IUPAC name is 1,4-bis[(4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene]piperazine-1,4-diium.
| Compound Name | 1,4-bis[(4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene]piperazine-1,4-diium |
|---|---|
| PubChem CID | 162416394 |
| Molecular Formula | C38H44N6+2 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | 1,4-bis[(4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene]piperazine-1,4-diium |
| SMILES | CN1C(=[N+]2CC[N+](=C3N(C)[C@@H](c4ccccc4)[C@H](c4ccccc4)N3C)CC2)N(C)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C38H44N6/c1-39-33(29-17-9-5-10-18-29)34(30-19-11-6-12-20-30)40(2)37(39)43-25-27-44(28-26-43)38-41(3)35(31-21-13-7-14-22-31)36(42(38)4)32-23-15-8-16-24-32/h5-24,33-36H,25-28H2,1-4H3/q+2/t33-,34-,35-,36-/m0/s1 |
| InChIKey | GZWXIIVEYOMZIE-ZYADHFCISA-N |
| XLogP | 5.46 |
| TPSA | 18.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|