C20H31BFNO3 — CID 162416438
N-[1-(3-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,2-dimethylpropanamide (PubChem CID 162416438) has the molecular formula C20H31BFNO3 and a molecular weight of 363.28 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-(3-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 162416438 |
| Molecular Formula | C20H31BFNO3 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N-[1-(3-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC(CCB1OC(C)(C)C(C)(C)O1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H31BFNO3/c1-18(2,3)17(24)23-16(14-9-8-10-15(22)13-14)11-12-21-25-19(4,5)20(6,7)26-21/h8-10,13,16H,11-12H2,1-7H3,(H,23,24) |
| InChIKey | LYJDOSWAKVKVNR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|