About N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide
N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide (PubChem CID 162416662) has the molecular formula C11H23F3N2O2S
and a molecular weight of 304.38 g/mol. Its IUPAC name is N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide |
| PubChem CID | 162416662 |
| Molecular Formula | C11H23F3N2O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide |
| SMILES | CCCC[C@@H](N)CCN(C(C)C)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H23F3N2O2S/c1-4-5-6-10(15)7-8-16(9(2)3)19(17,18)11(12,13)14/h9-10H,4-8,15H2,1-3H3/t10-/m1/s1 |
| InChIKey | JESMNCZROCSUSN-SNVBAGLBSA-N |
| XLogP | 2.45 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide?
The IUPAC name of N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide (CID 162416662) is N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide.
What is the SMILES notation for N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide?
The canonical SMILES for N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide is CCCC[C@@H](N)CCN(C(C)C)S(=O)(=O)C(F)(F)F.
What is the InChIKey of N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide?
The InChIKey is JESMNCZROCSUSN-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H23F3N2O2S/c1-4-5-6-10(15)7-8-16(9(2)3)19(17,18)11(12,13)14/h9-10H,4-8,15H2,1-3H3/t10-/m1/s1.
What are the key properties of N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide?
N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide has a molecular weight of 304.38 g/mol, XLogP of 2.45, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-3-aminoheptyl]-1,1,1-trifluoro-N-propan-2-ylmethanesulfonamide is sourced from PubChem (CID 162416662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).