C28H50O6Si — CID 162416774
(1R,3S,4S,4'aS,5R,7'R,7'aR)-7'-ethoxy-4,6,6-trimethyl-5-[tri(propan-2-yl)silyloxymethyl]spiro[2-oxabicyclo[2.2.2]octane-3,2'-4,4a,7,7a-tetrahydro-3H-furo[3,4-b]pyran]-5'-one (PubChem CID 162416774) has the molecular formula C28H50O6Si and a molecular weight of 510.79 g/mol. Its IUPAC name is (1R,3S,4S,4'aS,5R,7'R,7'aR)-7'-ethoxy-4,6,6-trimethyl-5-[tri(propan-2-yl)silyloxymethyl]spiro[2-oxabicyclo[2.2.2]octane-3,2'-4,4a,7,7a-tetrahydro-3H-furo[3,4-b]pyran]-5'-one.
| Compound Name | (1R,3S,4S,4'aS,5R,7'R,7'aR)-7'-ethoxy-4,6,6-trimethyl-5-[tri(propan-2-yl)silyloxymethyl]spiro[2-oxabicyclo[2.2.2]octane-3,2'-4,4a,7,7a-tetrahydro-3H-furo[3,4-b]pyran]-5'-one |
|---|---|
| PubChem CID | 162416774 |
| Molecular Formula | C28H50O6Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | (1R,3S,4S,4'aS,5R,7'R,7'aR)-7'-ethoxy-4,6,6-trimethyl-5-[tri(propan-2-yl)silyloxymethyl]spiro[2-oxabicyclo[2.2.2]octane-3,2'-4,4a,7,7a-tetrahydro-3H-furo[3,4-b]pyran]-5'-one |
| SMILES | CCO[C@@H]1OC(=O)[C@H]2CC[C@@]3(O[C@@H]12)O[C@@H]1CC[C@@]3(C)[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)C1(C)C |
| InChI | InChI=1S/C28H50O6Si/c1-11-30-25-23-20(24(29)32-25)12-15-28(34-23)27(10)14-13-22(33-28)26(8,9)21(27)16-31-35(17(2)3,18(4)5)19(6)7/h17-23,25H,11-16H2,1-10H3/t20-,21+,22+,23+,25+,27-,28-/m0/s1 |
| InChIKey | AEUGUAIVHWOGFJ-YFFIHSRLSA-N |
| XLogP | 6.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|