C17H11N3O6 — CID 162416814
14,20-dimethoxy-12,16-dioxa-3,5,6-triazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),2,4(8),9,13,15(19),17-heptaene-7,11-dione (PubChem CID 162416814) has the molecular formula C17H11N3O6 and a molecular weight of 353.29 g/mol. Its IUPAC name is 14,20-dimethoxy-12,16-dioxa-3,5,6-triazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),2,4(8),9,13,15(19),17-heptaene-7,11-dione.
| Compound Name | 14,20-dimethoxy-12,16-dioxa-3,5,6-triazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),2,4(8),9,13,15(19),17-heptaene-7,11-dione |
|---|---|
| PubChem CID | 162416814 |
| Molecular Formula | C17H11N3O6 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 14,20-dimethoxy-12,16-dioxa-3,5,6-triazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1(20),2,4(8),9,13,15(19),17-heptaene-7,11-dione |
| SMILES | COc1c2occc2c(OC)c2c1oc(=O)c1cc3c(=O)[nH][nH]c3nc12 |
| InChI | InChI=1S/C17H11N3O6/c1-23-11-6-3-4-25-12(6)14(24-2)13-9(11)10-7(17(22)26-13)5-8-15(18-10)19-20-16(8)21/h3-5H,1-2H3,(H2,18,19,20,21) |
| InChIKey | ATJCZTKGMPVERB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|