C30H60O5Si3 — CID 162416828
(2S,3R,4S,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-ynyl]-6-prop-2-enyloxan-3-ol (PubChem CID 162416828) has the molecular formula C30H60O5Si3 and a molecular weight of 585.06 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-ynyl]-6-prop-2-enyloxan-3-ol.
| Compound Name | (2S,3R,4S,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-ynyl]-6-prop-2-enyloxan-3-ol |
|---|---|
| PubChem CID | 162416828 |
| Molecular Formula | C30H60O5Si3 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | (2S,3R,4S,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-ynyl]-6-prop-2-enyloxan-3-ol |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H](CC=C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C30H60O5Si3/c1-18-20-22-26(34-37(14,15)29(6,7)8)27(35-38(16,17)30(9,10)11)24(31)25(32-22)23(21-19-2)33-36(12,13)28(3,4)5/h2,18,22-27,31H,1,20-21H2,3-17H3/t22-,23-,24-,25-,26+,27+/m1/s1 |
| InChIKey | OSPUSYOAGFOFAE-QJCWEMJFSA-N |
| XLogP | 7.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|