C15H20O5 — CID 162416833
(7R,14R)-7-hydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione (PubChem CID 162416833) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (7R,14R)-7-hydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione.
| Compound Name | (7R,14R)-7-hydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
|---|---|
| PubChem CID | 162416833 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (7R,14R)-7-hydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
| SMILES | C[C@@H]1CCC23OC(=O)CC12[C@@H](O)C1(C)C(=O)OCC13C |
| InChI | InChI=1S/C15H20O5/c1-8-4-5-15-12(2)7-19-11(18)13(12,3)10(17)14(8,15)6-9(16)20-15/h8,10,17H,4-7H2,1-3H3/t8-,10+,12?,13?,14?,15?/m1/s1 |
| InChIKey | FOZQQQAHWXEURQ-VEEZAXLKSA-N |
| XLogP | 1.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |