C15H20O6 — CID 162416836
(7R,14S)-7,14-dihydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione (PubChem CID 162416836) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (7R,14S)-7,14-dihydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione.
| Compound Name | (7R,14S)-7,14-dihydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
|---|---|
| PubChem CID | 162416836 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (7R,14S)-7,14-dihydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
| SMILES | CC12C(=O)OCC1(C)C13CC[C@](C)(O)C1(CC(=O)O3)[C@H]2O |
| InChI | InChI=1S/C15H20O6/c1-11-7-20-10(18)13(11,3)9(17)14-6-8(16)21-15(11,14)5-4-12(14,2)19/h9,17,19H,4-7H2,1-3H3/t9-,11?,12-,13?,14?,15?/m0/s1 |
| InChIKey | NRWHGPZPTAZIGN-JWNDGWCBSA-N |
| XLogP | 0.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |