About 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one
1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one (PubChem CID 162416860) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one |
| PubChem CID | 162416860 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one |
| SMILES | CC/C=C/[C@H](CC)N1CCCC1=O |
| InChI | InChI=1S/C11H19NO/c1-3-5-7-10(4-2)12-9-6-8-11(12)13/h5,7,10H,3-4,6,8-9H2,1-2H3/b7-5+/t10-/m0/s1 |
| InChIKey | WIOFCEJSALFJPN-STUBTGCMSA-N |
| XLogP | 2.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one?
The IUPAC name of 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one (CID 162416860) is 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one?
The canonical SMILES for 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one is CC/C=C/[C@H](CC)N1CCCC1=O.
What is the InChIKey of 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one?
The InChIKey is WIOFCEJSALFJPN-STUBTGCMSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-5-7-10(4-2)12-9-6-8-11(12)13/h5,7,10H,3-4,6,8-9H2,1-2H3/b7-5+/t10-/m0/s1.
What are the key properties of 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one?
1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one has a molecular weight of 181.28 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E,3S)-hept-4-en-3-yl]pyrrolidin-2-one is sourced from PubChem (CID 162416860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).