About 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol
2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol (PubChem CID 162416925) has the molecular formula C22H25O2P
and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol |
| PubChem CID | 162416925 |
| Molecular Formula | C22H25O2P |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol |
| SMILES | CC(CO)(CP(=O)(c1ccccc1)c1ccccc1)C1C=CCC=C1 |
| InChI | InChI=1S/C22H25O2P/c1-22(17-23,19-11-5-2-6-12-19)18-25(24,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h3-16,19,23H,2,17-18H2,1H3 |
| InChIKey | AIDCJSCDSMQBLH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol?
The IUPAC name of 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol (CID 162416925) is 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol.
What is the SMILES notation for 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol?
The canonical SMILES for 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol is CC(CO)(CP(=O)(c1ccccc1)c1ccccc1)C1C=CCC=C1.
What is the InChIKey of 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol?
The InChIKey is AIDCJSCDSMQBLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25O2P/c1-22(17-23,19-11-5-2-6-12-19)18-25(24,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h3-16,19,23H,2,17-18H2,1H3.
What are the key properties of 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol?
2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol has a molecular weight of 352.41 g/mol, XLogP of 4.13, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,5-dien-1-yl-3-diphenylphosphoryl-2-methylpropan-1-ol is sourced from PubChem (CID 162416925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).