About benzyl (4S)-4-fluoropentanoate
benzyl (4S)-4-fluoropentanoate (PubChem CID 162416936) has the molecular formula C12H15FO2
and a molecular weight of 210.25 g/mol. Its IUPAC name is benzyl (4S)-4-fluoropentanoate.
Molecular Properties
| Compound Name | benzyl (4S)-4-fluoropentanoate |
| PubChem CID | 162416936 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | benzyl (4S)-4-fluoropentanoate |
| SMILES | C[C@H](F)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H15FO2/c1-10(13)7-8-12(14)15-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/t10-/m0/s1 |
| InChIKey | XIVJSJALZBPCIZ-JTQLQIEISA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl (4S)-4-fluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (4S)-4-fluoropentanoate?
The IUPAC name of benzyl (4S)-4-fluoropentanoate (CID 162416936) is benzyl (4S)-4-fluoropentanoate.
What is the SMILES notation for benzyl (4S)-4-fluoropentanoate?
The canonical SMILES for benzyl (4S)-4-fluoropentanoate is C[C@H](F)CCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl (4S)-4-fluoropentanoate?
The InChIKey is XIVJSJALZBPCIZ-JTQLQIEISA-N. The full InChI is InChI=1S/C12H15FO2/c1-10(13)7-8-12(14)15-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/t10-/m0/s1.
What are the key properties of benzyl (4S)-4-fluoropentanoate?
benzyl (4S)-4-fluoropentanoate has a molecular weight of 210.25 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (4S)-4-fluoropentanoate is sourced from PubChem (CID 162416936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).