C19H23NO2 — CID 162417272
(6R,9R,17S)-17-methyl-13-methylidene-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-ene-8,10-dione (PubChem CID 162417272) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (6R,9R,17S)-17-methyl-13-methylidene-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-ene-8,10-dione.
| Compound Name | (6R,9R,17S)-17-methyl-13-methylidene-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-ene-8,10-dione |
|---|---|
| PubChem CID | 162417272 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (6R,9R,17S)-17-methyl-13-methylidene-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-ene-8,10-dione |
| SMILES | C=C1CN2C(=O)[C@H]3C(=O)C[C@H]4CCCC4=C4CC1CC2[C@]43C |
| InChI | InChI=1S/C19H23NO2/c1-10-9-20-16-8-12(10)6-14-13-5-3-4-11(13)7-15(21)17(18(20)22)19(14,16)2/h11-12,16-17H,1,3-9H2,2H3/t11-,12?,16?,17-,19+/m1/s1 |
| InChIKey | YQIJHMFGMRHHGA-ZVZIETCESA-N |
| XLogP | 2.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|