About 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one
7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one (PubChem CID 162417326) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one.
Molecular Properties
| Compound Name | 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one |
| PubChem CID | 162417326 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one |
| SMILES | COc1ccc2c(c1)OCN(C)C2=O |
| InChI | InChI=1S/C10H11NO3/c1-11-6-14-9-5-7(13-2)3-4-8(9)10(11)12/h3-5H,6H2,1-2H3 |
| InChIKey | LXURTXVKLDYDAV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one?
The IUPAC name of 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one (CID 162417326) is 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one.
What is the SMILES notation for 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one?
The canonical SMILES for 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one is COc1ccc2c(c1)OCN(C)C2=O.
What is the InChIKey of 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one?
The InChIKey is LXURTXVKLDYDAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-11-6-14-9-5-7(13-2)3-4-8(9)10(11)12/h3-5H,6H2,1-2H3.
What are the key properties of 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one?
7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one has a molecular weight of 193.20 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3-methyl-2H-1,3-benzoxazin-4-one is sourced from PubChem (CID 162417326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).