C22H36O6 — CID 162417391
(4R,6R,8R,10S)-4-[(E)-4-hydroxybut-1-enyl]-10-(4-hydroxy-2-methylidenebutyl)-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-ol (PubChem CID 162417391) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is (4R,6R,8R,10S)-4-[(E)-4-hydroxybut-1-enyl]-10-(4-hydroxy-2-methylidenebutyl)-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-ol.
| Compound Name | (4R,6R,8R,10S)-4-[(E)-4-hydroxybut-1-enyl]-10-(4-hydroxy-2-methylidenebutyl)-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-ol |
|---|---|
| PubChem CID | 162417391 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (4R,6R,8R,10S)-4-[(E)-4-hydroxybut-1-enyl]-10-(4-hydroxy-2-methylidenebutyl)-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-ol |
| SMILES | C=C(CCO)C[C@@H]1CCC(C)(O)[C@]2(CC[C@@]3(CCC[C@H](/C=C/CCO)O3)O2)O1 |
| InChI | InChI=1S/C22H36O6/c1-17(9-15-24)16-19-8-11-20(2,25)22(27-19)13-12-21(28-22)10-5-7-18(26-21)6-3-4-14-23/h3,6,18-19,23-25H,1,4-5,7-16H2,2H3/b6-3+/t18-,19-,20?,21+,22+/m0/s1 |
| InChIKey | GPKGYDIOXLLPDL-OPDFYOBYSA-N |
| XLogP | 2.96 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|