C23H33BN2O2 — CID 162417621
4-[[4-(dimethylamino)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N,N-dimethylaniline (PubChem CID 162417621) has the molecular formula C23H33BN2O2 and a molecular weight of 380.34 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 162417621 |
| Molecular Formula | C23H33BN2O2 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(B2OC(C)(C)C(C)(C)O2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H33BN2O2/c1-22(2)23(3,4)28-24(27-22)21(17-9-13-19(14-10-17)25(5)6)18-11-15-20(16-12-18)26(7)8/h9-16,21H,1-8H3 |
| InChIKey | HQASEBDVZXYSMN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|