About (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol
(2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol (PubChem CID 162417662) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol.
Molecular Properties
| Compound Name | (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol |
| PubChem CID | 162417662 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol |
| SMILES | C=C/C=C\C[C@@](C)(O)c1ccc(OC)nc1 |
| InChI | InChI=1S/C13H17NO2/c1-4-5-6-9-13(2,15)11-7-8-12(16-3)14-10-11/h4-8,10,15H,1,9H2,2-3H3/b6-5-/t13-/m1/s1 |
| InChIKey | WYGAYOZNAUVGOK-CFHLNLSMSA-N |
| XLogP | 2.43 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol?
The IUPAC name of (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol (CID 162417662) is (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol.
What is the SMILES notation for (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol?
The canonical SMILES for (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol is C=C/C=C\C[C@@](C)(O)c1ccc(OC)nc1.
What is the InChIKey of (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol?
The InChIKey is WYGAYOZNAUVGOK-CFHLNLSMSA-N. The full InChI is InChI=1S/C13H17NO2/c1-4-5-6-9-13(2,15)11-7-8-12(16-3)14-10-11/h4-8,10,15H,1,9H2,2-3H3/b6-5-/t13-/m1/s1.
What are the key properties of (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol?
(2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol has a molecular weight of 219.28 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4Z)-2-(6-methoxy-3-pyridinyl)hepta-4,6-dien-2-ol is sourced from PubChem (CID 162417662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).