C23H42O6Si — CID 162417745
tert-butyl [(E,1R)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-oxoethyl)oxolan-2-yl]hex-3-enyl] carbonate (PubChem CID 162417745) has the molecular formula C23H42O6Si and a molecular weight of 442.67 g/mol. Its IUPAC name is tert-butyl [(E,1R)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-oxoethyl)oxolan-2-yl]hex-3-enyl] carbonate.
| Compound Name | tert-butyl [(E,1R)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-oxoethyl)oxolan-2-yl]hex-3-enyl] carbonate |
|---|---|
| PubChem CID | 162417745 |
| Molecular Formula | C23H42O6Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | tert-butyl [(E,1R)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-oxoethyl)oxolan-2-yl]hex-3-enyl] carbonate |
| SMILES | CC/C=C/C[C@@H](OC(=O)OC(C)(C)C)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC=O)O1 |
| InChI | InChI=1S/C23H42O6Si/c1-10-11-12-13-17(27-21(25)28-22(2,3)4)19-16-20(18(26-19)14-15-24)29-30(8,9)23(5,6)7/h11-12,15,17-20H,10,13-14,16H2,1-9H3/b12-11+/t17-,18+,19-,20+/m1/s1 |
| InChIKey | IULCTPIJNIMHHQ-RZXIEHSQSA-N |
| XLogP | 5.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|