C20H36N2O4 — CID 162417829
tert-butyl 4-[(3R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-en-3-yl]piperidine-1-carboxylate (PubChem CID 162417829) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is tert-butyl 4-[(3R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-en-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-en-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162417829 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | tert-butyl 4-[(3R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-en-3-yl]piperidine-1-carboxylate |
| SMILES | C=C[C@H](C1CCN(C(=O)OC(C)(C)C)CC1)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36N2O4/c1-9-16(14(2)21-17(23)25-19(3,4)5)15-10-12-22(13-11-15)18(24)26-20(6,7)8/h9,14-16H,1,10-13H2,2-8H3,(H,21,23)/t14-,16-/m0/s1 |
| InChIKey | MWDHVUKVCOQCHG-HOCLYGCPSA-N |
| XLogP | 4.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|