About methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate
methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate (PubChem CID 162417834) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate |
| PubChem CID | 162417834 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate |
| SMILES | C=CC1CC(C(=O)OC)=C(N)S1 |
| InChI | InChI=1S/C8H11NO2S/c1-3-5-4-6(7(9)12-5)8(10)11-2/h3,5H,1,4,9H2,2H3 |
| InChIKey | XRFWYIGMHFJUPN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate?
The IUPAC name of methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate (CID 162417834) is methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate.
What is the SMILES notation for methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate?
The canonical SMILES for methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate is C=CC1CC(C(=O)OC)=C(N)S1.
What is the InChIKey of methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate?
The InChIKey is XRFWYIGMHFJUPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-3-5-4-6(7(9)12-5)8(10)11-2/h3,5H,1,4,9H2,2H3.
What are the key properties of methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate?
methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate has a molecular weight of 185.25 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-2-ethenyl-2,3-dihydrothiophene-4-carboxylate is sourced from PubChem (CID 162417834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).