C11H16O6 — CID 162417842
methyl (3aS,6R,7S,7aR)-6,7-dihydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate (PubChem CID 162417842) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is methyl (3aS,6R,7S,7aR)-6,7-dihydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate.
| Compound Name | methyl (3aS,6R,7S,7aR)-6,7-dihydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 162417842 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | methyl (3aS,6R,7S,7aR)-6,7-dihydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](O)[C@H](O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C11H16O6/c1-11(2)16-8-5(10(14)15-3)4-6(12)7(13)9(8)17-11/h4,6-9,12-13H,1-3H3/t6-,7+,8+,9-/m1/s1 |
| InChIKey | SQIJDRIJLCRGGV-RYPBNFRJSA-N |
| XLogP | -0.66 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |