C22H34FNO4 — CID 162418020
(4-fluoro-5-phenylpentyl) (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 162418020) has the molecular formula C22H34FNO4 and a molecular weight of 395.52 g/mol. Its IUPAC name is (4-fluoro-5-phenylpentyl) (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | (4-fluoro-5-phenylpentyl) (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 162418020 |
| Molecular Formula | C22H34FNO4 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (4-fluoro-5-phenylpentyl) (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)OCCCC(F)Cc1ccccc1 |
| InChI | InChI=1S/C22H34FNO4/c1-16(2)14-19(24-21(26)28-22(3,4)5)20(25)27-13-9-12-18(23)15-17-10-7-6-8-11-17/h6-8,10-11,16,18-19H,9,12-15H2,1-5H3,(H,24,26)/t18?,19-/m0/s1 |
| InChIKey | FHHYLWWQGUAJGT-GGYWPGCISA-N |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|