C22H26N2O5 — CID 162418026
11-O-tert-butyl 3-O-methyl (1R,3S,10R)-8-oxo-4,11-diazatetracyclo[8.7.0.01,5.012,17]heptadeca-4,12,14,16-tetraene-3,11-dicarboxylate (PubChem CID 162418026) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 11-O-tert-butyl 3-O-methyl (1R,3S,10R)-8-oxo-4,11-diazatetracyclo[8.7.0.01,5.012,17]heptadeca-4,12,14,16-tetraene-3,11-dicarboxylate.
| Compound Name | 11-O-tert-butyl 3-O-methyl (1R,3S,10R)-8-oxo-4,11-diazatetracyclo[8.7.0.01,5.012,17]heptadeca-4,12,14,16-tetraene-3,11-dicarboxylate |
|---|---|
| PubChem CID | 162418026 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 11-O-tert-butyl 3-O-methyl (1R,3S,10R)-8-oxo-4,11-diazatetracyclo[8.7.0.01,5.012,17]heptadeca-4,12,14,16-tetraene-3,11-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]23C(=N1)CCC(=O)C[C@H]2N(C(=O)OC(C)(C)C)c1ccccc13 |
| InChI | InChI=1S/C22H26N2O5/c1-21(2,3)29-20(27)24-16-8-6-5-7-14(16)22-12-15(19(26)28-4)23-17(22)10-9-13(25)11-18(22)24/h5-8,15,18H,9-12H2,1-4H3/t15-,18+,22-/m0/s1 |
| InChIKey | YBNCWURMKWIGKQ-REDKUUPNSA-N |
| XLogP | 3.19 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |