About 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine
3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine (PubChem CID 162418112) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine.
Molecular Properties
| Compound Name | 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine |
| PubChem CID | 162418112 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine |
| SMILES | Cc1cnc(C)c([C@@H]2COCCO2)n1 |
| InChI | InChI=1S/C10H14N2O2/c1-7-5-11-8(2)10(12-7)9-6-13-3-4-14-9/h5,9H,3-4,6H2,1-2H3/t9-/m0/s1 |
| InChIKey | ZTLYBHKPMFSTES-VIFPVBQESA-N |
| XLogP | 1.18 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine?
The IUPAC name of 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine (CID 162418112) is 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine.
What is the SMILES notation for 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine?
The canonical SMILES for 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine is Cc1cnc(C)c([C@@H]2COCCO2)n1.
What is the InChIKey of 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine?
The InChIKey is ZTLYBHKPMFSTES-VIFPVBQESA-N. The full InChI is InChI=1S/C10H14N2O2/c1-7-5-11-8(2)10(12-7)9-6-13-3-4-14-9/h5,9H,3-4,6H2,1-2H3/t9-/m0/s1.
What are the key properties of 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine?
3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine has a molecular weight of 194.23 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R)-1,4-dioxan-2-yl]-2,5-dimethylpyrazine is sourced from PubChem (CID 162418112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).