C12H17F3O — CID 162418237
3,3,3-trifluoro-2-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]propan-1-ol (PubChem CID 162418237) has the molecular formula C12H17F3O and a molecular weight of 234.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]propan-1-ol.
| Compound Name | 3,3,3-trifluoro-2-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 162418237 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3,3,3-trifluoro-2-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]propan-1-ol |
| SMILES | C=C(C)[C@@H]1CC=C(C(CO)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H17F3O/c1-8(2)9-3-5-10(6-4-9)11(7-16)12(13,14)15/h5,9,11,16H,1,3-4,6-7H2,2H3/t9-,11?/m1/s1 |
| InChIKey | LLXOPULJAXUQMG-BFHBGLAWSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|