C26H44O2Si — CID 162418273
(1S,7R)-3-[(1R,3R,4Z)-3,6-dimethyl-1-triethylsilyloxyhepta-4,6-dienyl]-5,8,8-trimethylbicyclo[5.1.0]oct-2-en-4-one (PubChem CID 162418273) has the molecular formula C26H44O2Si and a molecular weight of 416.72 g/mol. Its IUPAC name is (1S,7R)-3-[(1R,3R,4Z)-3,6-dimethyl-1-triethylsilyloxyhepta-4,6-dienyl]-5,8,8-trimethylbicyclo[5.1.0]oct-2-en-4-one.
| Compound Name | (1S,7R)-3-[(1R,3R,4Z)-3,6-dimethyl-1-triethylsilyloxyhepta-4,6-dienyl]-5,8,8-trimethylbicyclo[5.1.0]oct-2-en-4-one |
|---|---|
| PubChem CID | 162418273 |
| Molecular Formula | C26H44O2Si |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (1S,7R)-3-[(1R,3R,4Z)-3,6-dimethyl-1-triethylsilyloxyhepta-4,6-dienyl]-5,8,8-trimethylbicyclo[5.1.0]oct-2-en-4-one |
| SMILES | C=C(C)/C=C\[C@H](C)C[C@@H](O[Si](CC)(CC)CC)C1=C[C@H]2[C@@H](CC(C)C1=O)C2(C)C |
| InChI | InChI=1S/C26H44O2Si/c1-10-29(11-2,12-3)28-24(15-19(6)14-13-18(4)5)21-17-23-22(26(23,8)9)16-20(7)25(21)27/h13-14,17,19-20,22-24H,4,10-12,15-16H2,1-3,5-9H3/b14-13-/t19-,20?,22+,23-,24+/m0/s1 |
| InChIKey | ZPGPZCRDUXZILW-VEVRMPJWSA-N |
| XLogP | 7.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|