C18H31NO6 — CID 162418311
methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]hept-6-enoate (PubChem CID 162418311) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]hept-6-enoate.
| Compound Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]hept-6-enoate |
|---|---|
| PubChem CID | 162418311 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]hept-6-enoate |
| SMILES | C=CCCCC(C(=O)OC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO6/c1-9-10-11-12-13(14(20)23-8)19(15(21)24-17(2,3)4)16(22)25-18(5,6)7/h9,13H,1,10-12H2,2-8H3 |
| InChIKey | JXCSHSXMDQVJFV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|