C26H46O3Si — CID 162418355
tert-butyl 6-[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]hex-5-enoate (PubChem CID 162418355) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is tert-butyl 6-[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]hex-5-enoate.
| Compound Name | tert-butyl 6-[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]hex-5-enoate |
|---|---|
| PubChem CID | 162418355 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | tert-butyl 6-[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]hex-5-enoate |
| SMILES | CC(C)(C)OC(=O)CCCC=C=C1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C26H46O3Si/c1-24(2,3)28-23(27)16-12-10-11-14-20-17-18-21-22(15-13-19-26(20,21)7)29-30(8,9)25(4,5)6/h11,21-22H,10,12-13,15-19H2,1-9H3/t14?,21-,22-,26+/m0/s1 |
| InChIKey | AUWZVQXIKBCJKX-HJGAUPOZSA-N |
| XLogP | 7.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|