C15H21NO3 — CID 162418723
1-[[(1S)-2-oxo-1-prop-2-enylcyclohexyl]methyl]piperidine-2,6-dione (PubChem CID 162418723) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[[(1S)-2-oxo-1-prop-2-enylcyclohexyl]methyl]piperidine-2,6-dione.
| Compound Name | 1-[[(1S)-2-oxo-1-prop-2-enylcyclohexyl]methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162418723 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-[[(1S)-2-oxo-1-prop-2-enylcyclohexyl]methyl]piperidine-2,6-dione |
| SMILES | C=CC[C@]1(CN2C(=O)CCCC2=O)CCCCC1=O |
| InChI | InChI=1S/C15H21NO3/c1-2-9-15(10-4-3-6-12(15)17)11-16-13(18)7-5-8-14(16)19/h2H,1,3-11H2/t15-/m1/s1 |
| InChIKey | BUGOTAYICIPBRZ-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|