C13H19BrO4 — CID 162418772
methyl (E)-4-[(2R,3S,4S)-2-(3-bromopropyl)-4-methyl-5-oxooxolan-3-yl]but-2-enoate (PubChem CID 162418772) has the molecular formula C13H19BrO4 and a molecular weight of 319.20 g/mol. Its IUPAC name is methyl (E)-4-[(2R,3S,4S)-2-(3-bromopropyl)-4-methyl-5-oxooxolan-3-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(2R,3S,4S)-2-(3-bromopropyl)-4-methyl-5-oxooxolan-3-yl]but-2-enoate |
|---|---|
| PubChem CID | 162418772 |
| Molecular Formula | C13H19BrO4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | methyl (E)-4-[(2R,3S,4S)-2-(3-bromopropyl)-4-methyl-5-oxooxolan-3-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H]1[C@H](C)C(=O)O[C@@H]1CCCBr |
| InChI | InChI=1S/C13H19BrO4/c1-9-10(5-3-7-12(15)17-2)11(6-4-8-14)18-13(9)16/h3,7,9-11H,4-6,8H2,1-2H3/b7-3+/t9-,10-,11+/m0/s1 |
| InChIKey | XKHDKGDQQDVZEV-TZRMHZCJSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|