C18H15F9O4 — CID 162418785
phenyl (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-formyloxybutyl)hept-2-enoate (PubChem CID 162418785) has the molecular formula C18H15F9O4 and a molecular weight of 466.30 g/mol. Its IUPAC name is phenyl (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-formyloxybutyl)hept-2-enoate.
| Compound Name | phenyl (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-formyloxybutyl)hept-2-enoate |
|---|---|
| PubChem CID | 162418785 |
| Molecular Formula | C18H15F9O4 |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | phenyl (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-formyloxybutyl)hept-2-enoate |
| SMILES | O=COCCCC/C(=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H15F9O4/c19-15(20,16(21,22)17(23,24)18(25,26)27)10-12(6-4-5-9-30-11-28)14(29)31-13-7-2-1-3-8-13/h1-3,7-8,10-11H,4-6,9H2/b12-10+ |
| InChIKey | ICSMRYQDOUBKOF-ZRDIBKRKSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|