C17H8F10O2S — CID 162418786
(4-fluorophenyl) (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-thiophen-3-ylhept-2-enoate (PubChem CID 162418786) has the molecular formula C17H8F10O2S and a molecular weight of 466.30 g/mol. Its IUPAC name is (4-fluorophenyl) (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-thiophen-3-ylhept-2-enoate.
| Compound Name | (4-fluorophenyl) (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-thiophen-3-ylhept-2-enoate |
|---|---|
| PubChem CID | 162418786 |
| Molecular Formula | C17H8F10O2S |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | (4-fluorophenyl) (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-thiophen-3-ylhept-2-enoate |
| SMILES | O=C(Oc1ccc(F)cc1)/C(=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccsc1 |
| InChI | InChI=1S/C17H8F10O2S/c18-10-1-3-11(4-2-10)29-13(28)12(9-5-6-30-8-9)7-14(19,20)15(21,22)16(23,24)17(25,26)27/h1-8H/b12-7+ |
| InChIKey | RQWZTBMSARYTHA-KPKJPENVSA-N |
| XLogP | 6.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|