C20H28O — CID 162418920
1-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-5-phenylpentan-1-ol (PubChem CID 162418920) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-5-phenylpentan-1-ol.
| Compound Name | 1-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-5-phenylpentan-1-ol |
|---|---|
| PubChem CID | 162418920 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-5-phenylpentan-1-ol |
| SMILES | CC1(C)[C@@H]2CC=C(C(O)CCCCc3ccccc3)[C@H]1C2 |
| InChI | InChI=1S/C20H28O/c1-20(2)16-12-13-17(18(20)14-16)19(21)11-7-6-10-15-8-4-3-5-9-15/h3-5,8-9,13,16,18-19,21H,6-7,10-12,14H2,1-2H3/t16-,18-,19?/m1/s1 |
| InChIKey | NGQNCGFJKGGKPL-SYUDBMKNSA-N |
| XLogP | 4.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|