C19H10BrCl2O6P — CID 162419042
[5-bromo-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)phenyl]phosphonic acid (PubChem CID 162419042) has the molecular formula C19H10BrCl2O6P and a molecular weight of 516.07 g/mol. Its IUPAC name is [5-bromo-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)phenyl]phosphonic acid.
| Compound Name | [5-bromo-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 162419042 |
| Molecular Formula | C19H10BrCl2O6P |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 513.88 |
| IUPAC Name | [5-bromo-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)phenyl]phosphonic acid |
| SMILES | O=c1cc2oc3cc(O)c(Cl)cc3c(-c3ccc(Br)cc3P(=O)(O)O)c-2cc1Cl |
| InChI | InChI=1S/C19H10BrCl2O6P/c20-8-1-2-9(18(3-8)29(25,26)27)19-10-4-12(21)14(23)6-16(10)28-17-7-15(24)13(22)5-11(17)19/h1-7,23H,(H2,25,26,27) |
| InChIKey | WZDGICAXMJLOIW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|