About 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one
3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one (PubChem CID 162419082) has the molecular formula C15H17ClO
and a molecular weight of 248.75 g/mol. Its IUPAC name is 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one.
Molecular Properties
| Compound Name | 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one |
| PubChem CID | 162419082 |
| Molecular Formula | C15H17ClO |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one |
| SMILES | CCC1=C(CC)c2cc(Cl)ccc2CCC1=O |
| InChI | InChI=1S/C15H17ClO/c1-3-12-13(4-2)15(17)8-6-10-5-7-11(16)9-14(10)12/h5,7,9H,3-4,6,8H2,1-2H3 |
| InChIKey | NIIWLMDLRYUPBU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one?
The IUPAC name of 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one (CID 162419082) is 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one.
What is the SMILES notation for 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one?
The canonical SMILES for 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one is CCC1=C(CC)c2cc(Cl)ccc2CCC1=O.
What is the InChIKey of 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one?
The InChIKey is NIIWLMDLRYUPBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClO/c1-3-12-13(4-2)15(17)8-6-10-5-7-11(16)9-14(10)12/h5,7,9H,3-4,6,8H2,1-2H3.
What are the key properties of 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one?
3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one has a molecular weight of 248.75 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6-diethyl-8,9-dihydrobenzo[7]annulen-7-one is sourced from PubChem (CID 162419082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).