About 2,3-dibromopropylazanium
2,3-dibromopropylazanium (PubChem CID 162419213) has the molecular formula C3H8Br2N+
and a molecular weight of 217.91 g/mol. Its IUPAC name is 2,3-dibromopropylazanium.
Molecular Properties
| Compound Name | 2,3-dibromopropylazanium |
| PubChem CID | 162419213 |
| Molecular Formula | C3H8Br2N+ |
| Molecular Weight | 217.91 g/mol |
| Exact Mass | 215.90 |
| IUPAC Name | 2,3-dibromopropylazanium |
| SMILES | [NH3+]CC(Br)CBr |
| InChI | InChI=1S/C3H7Br2N/c4-1-3(5)2-6/h3H,1-2,6H2/p+1 |
| InChIKey | VKQMAOOHJWXMPL-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.91 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromopropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromopropylazanium?
The IUPAC name of 2,3-dibromopropylazanium (CID 162419213) is 2,3-dibromopropylazanium.
What is the SMILES notation for 2,3-dibromopropylazanium?
The canonical SMILES for 2,3-dibromopropylazanium is [NH3+]CC(Br)CBr.
What is the InChIKey of 2,3-dibromopropylazanium?
The InChIKey is VKQMAOOHJWXMPL-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7Br2N/c4-1-3(5)2-6/h3H,1-2,6H2/p+1.
What are the key properties of 2,3-dibromopropylazanium?
2,3-dibromopropylazanium has a molecular weight of 217.91 g/mol, XLogP of 0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromopropylazanium is sourced from PubChem (CID 162419213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).