About [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol
[(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol (PubChem CID 162419215) has the molecular formula C12H15BrO2
and a molecular weight of 271.15 g/mol. Its IUPAC name is [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol.
Molecular Properties
| Compound Name | [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol |
| PubChem CID | 162419215 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol |
| SMILES | OC[C@H]1CCO[C@@H](c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C12H15BrO2/c13-11-3-1-10(2-4-11)12-7-9(8-14)5-6-15-12/h1-4,9,12,14H,5-8H2/t9-,12+/m0/s1 |
| InChIKey | WYWVVFBTFOUHGL-JOYOIKCWSA-N |
| XLogP | 2.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol?
The IUPAC name of [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol (CID 162419215) is [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol.
What is the SMILES notation for [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol?
The canonical SMILES for [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol is OC[C@H]1CCO[C@@H](c2ccc(Br)cc2)C1.
What is the InChIKey of [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol?
The InChIKey is WYWVVFBTFOUHGL-JOYOIKCWSA-N. The full InChI is InChI=1S/C12H15BrO2/c13-11-3-1-10(2-4-11)12-7-9(8-14)5-6-15-12/h1-4,9,12,14H,5-8H2/t9-,12+/m0/s1.
What are the key properties of [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol?
[(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol has a molecular weight of 271.15 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-2-(4-bromophenyl)oxan-4-yl]methanol is sourced from PubChem (CID 162419215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).