C14H12OS — CID 162419229
(1R,9S)-10-oxa-12-thiatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,11(15),13-pentaene (PubChem CID 162419229) has the molecular formula C14H12OS and a molecular weight of 228.32 g/mol. Its IUPAC name is (1R,9S)-10-oxa-12-thiatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,11(15),13-pentaene.
| Compound Name | (1R,9S)-10-oxa-12-thiatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,11(15),13-pentaene |
|---|---|
| PubChem CID | 162419229 |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (1R,9S)-10-oxa-12-thiatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,11(15),13-pentaene |
| SMILES | c1ccc2c(c1)C[C@@H]1Oc3sccc3C[C@H]21 |
| InChI | InChI=1S/C14H12OS/c1-2-4-11-9(3-1)8-13-12(11)7-10-5-6-16-14(10)15-13/h1-6,12-13H,7-8H2/t12-,13+/m1/s1 |
| InChIKey | OGYQXKXERXAKLV-OLZOCXBDSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |