About 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one
2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one (PubChem CID 162419440) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one.
Molecular Properties
| Compound Name | 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one |
| PubChem CID | 162419440 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one |
| SMILES | CC(C)(C)N1CC2(C=CCC=C2)CC1=O |
| InChI | InChI=1S/C13H19NO/c1-12(2,3)14-10-13(9-11(14)15)7-5-4-6-8-13/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | INYZVPNBDVGTKQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one?
The IUPAC name of 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one (CID 162419440) is 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one.
What is the SMILES notation for 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one?
The canonical SMILES for 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one is CC(C)(C)N1CC2(C=CCC=C2)CC1=O.
What is the InChIKey of 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one?
The InChIKey is INYZVPNBDVGTKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-12(2,3)14-10-13(9-11(14)15)7-5-4-6-8-13/h5-8H,4,9-10H2,1-3H3.
What are the key properties of 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one?
2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one has a molecular weight of 205.30 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2-azaspiro[4.5]deca-6,9-dien-3-one is sourced from PubChem (CID 162419440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).