C20H19NO6 — CID 162419548
(7S,9S)-9-acetyl-9-amino-6,7,11-trihydroxy-7,8,10,11a-tetrahydro-5aH-tetracene-5,12-dione (PubChem CID 162419548) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-9-amino-6,7,11-trihydroxy-7,8,10,11a-tetrahydro-5aH-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-9-amino-6,7,11-trihydroxy-7,8,10,11a-tetrahydro-5aH-tetracene-5,12-dione |
|---|---|
| PubChem CID | 162419548 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (7S,9S)-9-acetyl-9-amino-6,7,11-trihydroxy-7,8,10,11a-tetrahydro-5aH-tetracene-5,12-dione |
| SMILES | CC(=O)[C@]1(N)CC2=C(O)C3C(=O)c4ccccc4C(=O)C3C(O)=C2[C@@H](O)C1 |
| InChI | InChI=1S/C20H19NO6/c1-8(22)20(21)6-11-13(12(23)7-20)19(27)15-14(18(11)26)16(24)9-4-2-3-5-10(9)17(15)25/h2-5,12,14-15,23,26-27H,6-7,21H2,1H3/t12-,14?,15?,20-/m0/s1 |
| InChIKey | UEGRJVRMFMXKJD-BDDLQLCDSA-N |
| XLogP | 1.38 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|