C26H34O8 — CID 162419633
[(1'S,3'R,4'R,11'S,13'S)-16',16'-dimethoxy-2,2-dimethyl-10',17'-dioxospiro[1,3-dioxane-5,5'-tetracyclo[11.2.2.01,11.04,9]heptadeca-8,14-diene]-3'-yl] acetate (PubChem CID 162419633) has the molecular formula C26H34O8 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(1'S,3'R,4'R,11'S,13'S)-16',16'-dimethoxy-2,2-dimethyl-10',17'-dioxospiro[1,3-dioxane-5,5'-tetracyclo[11.2.2.01,11.04,9]heptadeca-8,14-diene]-3'-yl] acetate.
| Compound Name | [(1'S,3'R,4'R,11'S,13'S)-16',16'-dimethoxy-2,2-dimethyl-10',17'-dioxospiro[1,3-dioxane-5,5'-tetracyclo[11.2.2.01,11.04,9]heptadeca-8,14-diene]-3'-yl] acetate |
|---|---|
| PubChem CID | 162419633 |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(1'S,3'R,4'R,11'S,13'S)-16',16'-dimethoxy-2,2-dimethyl-10',17'-dioxospiro[1,3-dioxane-5,5'-tetracyclo[11.2.2.01,11.04,9]heptadeca-8,14-diene]-3'-yl] acetate |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C[C@]13C[C@@H](OC(C)=O)[C@H]1C(=CCCC14COC(C)(C)OC4)C(=O)[C@H]3C2 |
| InChI | InChI=1S/C26H34O8/c1-15(27)34-19-12-25-10-8-16(22(29)26(25,30-4)31-5)11-18(25)21(28)17-7-6-9-24(20(17)19)13-32-23(2,3)33-14-24/h7-8,10,16,18-20H,6,9,11-14H2,1-5H3/t16-,18-,19-,20-,25-/m1/s1 |
| InChIKey | JYMXIXVZQXFOMB-JKSLYCOKSA-N |
| XLogP | 2.75 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|