C25H30F3NO4Si — CID 162419750
methyl (3S)-3-[4-[dimethyl(prop-2-enyl)silyl]phenyl]-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]propanoate (PubChem CID 162419750) has the molecular formula C25H30F3NO4Si and a molecular weight of 493.60 g/mol. Its IUPAC name is methyl (3S)-3-[4-[dimethyl(prop-2-enyl)silyl]phenyl]-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]propanoate.
| Compound Name | methyl (3S)-3-[4-[dimethyl(prop-2-enyl)silyl]phenyl]-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 162419750 |
| Molecular Formula | C25H30F3NO4Si |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | methyl (3S)-3-[4-[dimethyl(prop-2-enyl)silyl]phenyl]-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]propanoate |
| SMILES | C=CC[Si](C)(C)c1ccc([C@H](CC(=O)OC)NC(=O)[C@](OC)(c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H30F3NO4Si/c1-6-16-34(4,5)20-14-12-18(13-15-20)21(17-22(30)32-2)29-23(31)24(33-3,25(26,27)28)19-10-8-7-9-11-19/h6-15,21H,1,16-17H2,2-5H3,(H,29,31)/t21-,24+/m0/s1 |
| InChIKey | KPYFQJGUECVHSU-XUZZJYLKSA-N |
| XLogP | 4.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|