About cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol
cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol (PubChem CID 162419779) has the molecular formula C16H19NOS
and a molecular weight of 273.40 g/mol. Its IUPAC name is cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol |
| PubChem CID | 162419779 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1ccccc1)(c1nccs1)C1CCCCC1 |
| InChI | InChI=1S/C16H19NOS/c18-16(15-17-11-12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14,18H,2,5-6,9-10H2 |
| InChIKey | SEASQVMTRVWKNU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol?
The IUPAC name of cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol (CID 162419779) is cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol.
What is the SMILES notation for cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol?
The canonical SMILES for cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol is OC(c1ccccc1)(c1nccs1)C1CCCCC1.
What is the InChIKey of cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol?
The InChIKey is SEASQVMTRVWKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NOS/c18-16(15-17-11-12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14,18H,2,5-6,9-10H2.
What are the key properties of cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol?
cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol has a molecular weight of 273.40 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-phenyl-(1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 162419779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).