About CID 162419816
CID 162419816 (PubChem CID 162419816) has the molecular formula C13H18NO
and a molecular weight of 204.29 g/mol.
Molecular Properties
| Compound Name | CID 162419816 |
| PubChem CID | 162419816 |
| Molecular Formula | C13H18NO |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N1CC2(C=C[CH]C=C2)CC1=O |
| InChI | InChI=1S/C13H18NO/c1-12(2,3)14-10-13(9-11(14)15)7-5-4-6-8-13/h4-8H,9-10H2,1-3H3 |
| InChIKey | GQGSEFYSRBZGQQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 162419816 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162419816?
The IUPAC name of CID 162419816 (CID 162419816) is not available.
What is the SMILES notation for CID 162419816?
The canonical SMILES for CID 162419816 is CC(C)(C)N1CC2(C=C[CH]C=C2)CC1=O.
What is the InChIKey of CID 162419816?
The InChIKey is GQGSEFYSRBZGQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18NO/c1-12(2,3)14-10-13(9-11(14)15)7-5-4-6-8-13/h4-8H,9-10H2,1-3H3.
What are the key properties of CID 162419816?
CID 162419816 has a molecular weight of 204.29 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162419816 is sourced from PubChem (CID 162419816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).