C24H30O4Si — CID 162420005
(1aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methylphenyl)methoxy]-7,7a-dihydro-1aH-naphtho[2,3-b]oxiren-2-one (PubChem CID 162420005) has the molecular formula C24H30O4Si and a molecular weight of 410.59 g/mol. Its IUPAC name is (1aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methylphenyl)methoxy]-7,7a-dihydro-1aH-naphtho[2,3-b]oxiren-2-one.
| Compound Name | (1aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methylphenyl)methoxy]-7,7a-dihydro-1aH-naphtho[2,3-b]oxiren-2-one |
|---|---|
| PubChem CID | 162420005 |
| Molecular Formula | C24H30O4Si |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (1aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methylphenyl)methoxy]-7,7a-dihydro-1aH-naphtho[2,3-b]oxiren-2-one |
| SMILES | Cc1ccc(COc2cccc3c2C(=O)[C@@H]2O[C@@H]2[C@@H]3O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H30O4Si/c1-15-10-12-16(13-11-15)14-26-18-9-7-8-17-19(18)20(25)22-23(27-22)21(17)28-29(5,6)24(2,3)4/h7-13,21-23H,14H2,1-6H3/t21-,22+,23-/m1/s1 |
| InChIKey | ZWGDNZDMDIJWFC-XPWALMASSA-N |
| XLogP | 5.60 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|