C20H24O5 — CID 162420040
dimethyl (1R,5R,8S,13S,14R,15R)-2-oxotetracyclo[11.2.1.05,15.08,14]hexadeca-3,9-diene-5,8-dicarboxylate (PubChem CID 162420040) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is dimethyl (1R,5R,8S,13S,14R,15R)-2-oxotetracyclo[11.2.1.05,15.08,14]hexadeca-3,9-diene-5,8-dicarboxylate.
| Compound Name | dimethyl (1R,5R,8S,13S,14R,15R)-2-oxotetracyclo[11.2.1.05,15.08,14]hexadeca-3,9-diene-5,8-dicarboxylate |
|---|---|
| PubChem CID | 162420040 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | dimethyl (1R,5R,8S,13S,14R,15R)-2-oxotetracyclo[11.2.1.05,15.08,14]hexadeca-3,9-diene-5,8-dicarboxylate |
| SMILES | COC(=O)[C@]12C=CCC[C@H]3C[C@H]4C(=O)C=C[C@](C(=O)OC)(CC1)[C@@H]4[C@@H]32 |
| InChI | InChI=1S/C20H24O5/c1-24-17(22)19-7-4-3-5-12-11-13-14(21)6-8-20(10-9-19,18(23)25-2)16(13)15(12)19/h4,6-8,12-13,15-16H,3,5,9-11H2,1-2H3/t12-,13-,15+,16-,19+,20-/m0/s1 |
| InChIKey | ROYSZTJQUMWHOO-RBVUZAMOSA-N |
| XLogP | 2.46 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|