About 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine
2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine (PubChem CID 162420194) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine.
Molecular Properties
| Compound Name | 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine |
| PubChem CID | 162420194 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine |
| SMILES | Cc1ccnc([C@H]2COCCO2)n1 |
| InChI | InChI=1S/C9H12N2O2/c1-7-2-3-10-9(11-7)8-6-12-4-5-13-8/h2-3,8H,4-6H2,1H3/t8-/m1/s1 |
| InChIKey | IFQFMMBUGZCYFP-MRVPVSSYSA-N |
| XLogP | 0.87 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine?
The IUPAC name of 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine (CID 162420194) is 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine.
What is the SMILES notation for 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine?
The canonical SMILES for 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine is Cc1ccnc([C@H]2COCCO2)n1.
What is the InChIKey of 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine?
The InChIKey is IFQFMMBUGZCYFP-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-7-2-3-10-9(11-7)8-6-12-4-5-13-8/h2-3,8H,4-6H2,1H3/t8-/m1/s1.
What are the key properties of 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine?
2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine has a molecular weight of 180.21 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1,4-dioxan-2-yl]-4-methylpyrimidine is sourced from PubChem (CID 162420194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).