C24H28O3 — CID 162420201
[(1S,4S,5S)-4-(2,6-dimethoxy-4-phenylphenyl)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol (PubChem CID 162420201) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is [(1S,4S,5S)-4-(2,6-dimethoxy-4-phenylphenyl)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol.
| Compound Name | [(1S,4S,5S)-4-(2,6-dimethoxy-4-phenylphenyl)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol |
|---|---|
| PubChem CID | 162420201 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(1S,4S,5S)-4-(2,6-dimethoxy-4-phenylphenyl)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol |
| SMILES | COc1cc(-c2ccccc2)cc(OC)c1[C@H]1C=C(CO)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C24H28O3/c1-24(2)19-13-20(24)18(10-17(19)14-25)23-21(26-3)11-16(12-22(23)27-4)15-8-6-5-7-9-15/h5-12,18-20,25H,13-14H2,1-4H3/t18-,19+,20-/m0/s1 |
| InChIKey | MZIFOWIZQOXHEH-ZCNNSNEGSA-N |
| XLogP | 5.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|